About dipotassium;naphthalene-2,7-diolate
dipotassium;naphthalene-2,7-diolate (PubChem CID 102503984) has the molecular formula C10H6K2O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is dipotassium;naphthalene-2,7-diolate.
Molecular Properties
| Compound Name | dipotassium;naphthalene-2,7-diolate |
| PubChem CID | 102503984 |
| Molecular Formula | C10H6K2O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | dipotassium;naphthalene-2,7-diolate |
| SMILES | [K+].[K+].[O-]c1ccc2ccc([O-])cc2c1 |
| InChI | InChI=1S/C10H8O2.2K/c11-9-3-1-7-2-4-10(12)6-8(7)5-9;;/h1-6,11-12H;;/q;2*+1/p-2 |
| InChIKey | GEZNKLLXWMDWPZ-UHFFFAOYSA-L |
| XLogP | -5.01 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | -5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dipotassium;naphthalene-2,7-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;naphthalene-2,7-diolate?
The IUPAC name of dipotassium;naphthalene-2,7-diolate (CID 102503984) is dipotassium;naphthalene-2,7-diolate.
What is the SMILES notation for dipotassium;naphthalene-2,7-diolate?
The canonical SMILES for dipotassium;naphthalene-2,7-diolate is [K+].[K+].[O-]c1ccc2ccc([O-])cc2c1.
What is the InChIKey of dipotassium;naphthalene-2,7-diolate?
The InChIKey is GEZNKLLXWMDWPZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8O2.2K/c11-9-3-1-7-2-4-10(12)6-8(7)5-9;;/h1-6,11-12H;;/q;2*+1/p-2.
What are the key properties of dipotassium;naphthalene-2,7-diolate?
dipotassium;naphthalene-2,7-diolate has a molecular weight of 236.35 g/mol, XLogP of -5.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;naphthalene-2,7-diolate is sourced from PubChem (CID 102503984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).