About disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate
disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate (PubChem CID 102504033) has the molecular formula C6H3ClN2Na2O6S2
and a molecular weight of 344.67 g/mol. Its IUPAC name is disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate.
Molecular Properties
| Compound Name | disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate |
| PubChem CID | 102504033 |
| Molecular Formula | C6H3ClN2Na2O6S2 |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 343.89 |
| IUPAC Name | disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])/N=N/c1cc(S(=O)(=O)[O-])ccc1Cl.[Na+].[Na+] |
| InChI | InChI=1S/C6H5ClN2O6S2.2Na/c7-5-2-1-4(16(10,11)12)3-6(5)8-9-17(13,14)15;;/h1-3H,(H,10,11,12)(H,13,14,15);;/q;2*+1/p-2/b9-8+;; |
| InChIKey | UNDRMFUFCPAYQG-YEUQMBKVSA-L |
| XLogP | -5.20 |
| TPSA | 139.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | -5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate?
The IUPAC name of disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate (CID 102504033) is disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate.
What is the SMILES notation for disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate?
The canonical SMILES for disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate is O=S(=O)([O-])/N=N/c1cc(S(=O)(=O)[O-])ccc1Cl.[Na+].[Na+].
What is the InChIKey of disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate?
The InChIKey is UNDRMFUFCPAYQG-YEUQMBKVSA-L. The full InChI is InChI=1S/C6H5ClN2O6S2.2Na/c7-5-2-1-4(16(10,11)12)3-6(5)8-9-17(13,14)15;;/h1-3H,(H,10,11,12)(H,13,14,15);;/q;2*+1/p-2/b9-8+;;.
What are the key properties of disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate?
disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate has a molecular weight of 344.67 g/mol, XLogP of -5.20, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-chloro-3-(sulfonatodiazenyl)benzenesulfonate is sourced from PubChem (CID 102504033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).