C16H13N5O2S — CID 102504725
ethyl 2-(2,9,12,14,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaen-15-ylsulfanyl)acetate (PubChem CID 102504725) has the molecular formula C16H13N5O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is ethyl 2-(2,9,12,14,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaen-15-ylsulfanyl)acetate.
| Compound Name | ethyl 2-(2,9,12,14,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaen-15-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 102504725 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | ethyl 2-(2,9,12,14,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaen-15-ylsulfanyl)acetate |
| SMILES | CCOC(=O)CSc1ncnc2c1[nH]c1nc3ccccc3nc12 |
| InChI | InChI=1S/C16H13N5O2S/c1-2-23-11(22)7-24-16-14-12(17-8-18-16)13-15(21-14)20-10-6-4-3-5-9(10)19-13/h3-6,8H,2,7H2,1H3,(H,20,21) |
| InChIKey | DYUGSMNMRAIACM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |