C27H48O5S2Si — CID 102505082
(2R)-1-[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-1,3-dithian-2-yl]-3-(2-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 102505082) has the molecular formula C27H48O5S2Si and a molecular weight of 544.90 g/mol. Its IUPAC name is (2R)-1-[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-1,3-dithian-2-yl]-3-(2-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | (2R)-1-[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-1,3-dithian-2-yl]-3-(2-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 102505082 |
| Molecular Formula | C27H48O5S2Si |
| Molecular Weight | 544.90 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | (2R)-1-[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropyl]-1,3-dithian-2-yl]-3-(2-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COC(C)(C)OC[C@H](O)CC1(C[C@H](COCc2ccccc2)O[Si](C)(C)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C27H48O5S2Si/c1-25(2,3)35(7,8)32-24(21-30-19-22-13-10-9-11-14-22)18-27(33-15-12-16-34-27)17-23(28)20-31-26(4,5)29-6/h9-11,13-14,23-24,28H,12,15-21H2,1-8H3/t23-,24-/m1/s1 |
| InChIKey | GDTODHSYYCSMQC-DNQXCXABSA-N |
| XLogP | 6.70 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.90 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|