About methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate
methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate (PubChem CID 102505532) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate.
Molecular Properties
| Compound Name | methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate |
| PubChem CID | 102505532 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate |
| SMILES | CCC(C)N1C(C)=CC(=C(C#N)C(=O)OC)C=C1C |
| InChI | InChI=1S/C15H20N2O2/c1-6-10(2)17-11(3)7-13(8-12(17)4)14(9-16)15(18)19-5/h7-8,10H,6H2,1-5H3 |
| InChIKey | SLQARUKPLNAMCY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate?
The IUPAC name of methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate (CID 102505532) is methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate.
What is the SMILES notation for methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate?
The canonical SMILES for methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate is CCC(C)N1C(C)=CC(=C(C#N)C(=O)OC)C=C1C.
What is the InChIKey of methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate?
The InChIKey is SLQARUKPLNAMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-6-10(2)17-11(3)7-13(8-12(17)4)14(9-16)15(18)19-5/h7-8,10H,6H2,1-5H3.
What are the key properties of methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate?
methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate has a molecular weight of 260.34 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-butan-2-yl-2,6-dimethyl-4-pyridinylidene)-2-cyanoacetate is sourced from PubChem (CID 102505532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).