C22H35N3O5 — CID 102505974
tert-butyl N-[(2S)-1-[[(3S)-1-(methoxyamino)-5-methyl-2-oxohexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 102505974) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(3S)-1-(methoxyamino)-5-methyl-2-oxohexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(3S)-1-(methoxyamino)-5-methyl-2-oxohexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 102505974 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(3S)-1-(methoxyamino)-5-methyl-2-oxohexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CONCC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O5/c1-15(2)12-17(19(26)14-23-29-6)24-20(27)18(13-16-10-8-7-9-11-16)25-21(28)30-22(3,4)5/h7-11,15,17-18,23H,12-14H2,1-6H3,(H,24,27)(H,25,28)/t17-,18-/m0/s1 |
| InChIKey | SWHOPWGIRUUBKG-ROUUACIJSA-N |
| XLogP | 2.37 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|