C14H20O — CID 102506104
(4S,8R,13S)-8-methyltricyclo[6.4.1.04,13]tridec-1-en-7-one (PubChem CID 102506104) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (4S,8R,13S)-8-methyltricyclo[6.4.1.04,13]tridec-1-en-7-one.
| Compound Name | (4S,8R,13S)-8-methyltricyclo[6.4.1.04,13]tridec-1-en-7-one |
|---|---|
| PubChem CID | 102506104 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (4S,8R,13S)-8-methyltricyclo[6.4.1.04,13]tridec-1-en-7-one |
| SMILES | C[C@]12CCCCC3=CC[C@H](CCC1=O)[C@@H]32 |
| InChI | InChI=1S/C14H20O/c1-14-9-3-2-4-10-5-6-11(13(10)14)7-8-12(14)15/h5,11,13H,2-4,6-9H2,1H3/t11-,13-,14+/m1/s1 |
| InChIKey | PUUPYWABPPTHJJ-BNOWGMLFSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|