C25H36OSi — CID 102506110
tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane (PubChem CID 102506110) has the molecular formula C25H36OSi and a molecular weight of 380.65 g/mol. Its IUPAC name is tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane |
|---|---|
| PubChem CID | 102506110 |
| Molecular Formula | C25H36OSi |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane |
| SMILES | CCCCC[C@H]1C[C@@H](C[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H36OSi/c1-5-6-9-14-21-19-22(26-21)20-27(25(2,3)4,23-15-10-7-11-16-23)24-17-12-8-13-18-24/h7-8,10-13,15-18,21-22H,5-6,9,14,19-20H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | UBGKAWKEZWJVPU-VXKWHMMOSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|