About tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane
tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane (PubChem CID 102506110) has the molecular formula C25H36OSi
and a molecular weight of 380.65 g/mol. Its IUPAC name is tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane |
| PubChem CID | 102506110 |
| Molecular Formula | C25H36OSi |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane |
| SMILES | CCCCC[C@H]1C[C@@H](C[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H36OSi/c1-5-6-9-14-21-19-22(26-21)20-27(25(2,3)4,23-15-10-7-11-16-23)24-17-12-8-13-18-24/h7-8,10-13,15-18,21-22H,5-6,9,14,19-20H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | UBGKAWKEZWJVPU-VXKWHMMOSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane?
The IUPAC name of tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane (CID 102506110) is tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane.
What is the SMILES notation for tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane?
The canonical SMILES for tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane is CCCCC[C@H]1C[C@@H](C[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1.
What is the InChIKey of tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane?
The InChIKey is UBGKAWKEZWJVPU-VXKWHMMOSA-N. The full InChI is InChI=1S/C25H36OSi/c1-5-6-9-14-21-19-22(26-21)20-27(25(2,3)4,23-15-10-7-11-16-23)24-17-12-8-13-18-24/h7-8,10-13,15-18,21-22H,5-6,9,14,19-20H2,1-4H3/t21-,22-/m0/s1.
What are the key properties of tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane?
tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane has a molecular weight of 380.65 g/mol, XLogP of 5.79, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[[(2S,4S)-4-pentyloxetan-2-yl]methyl]-diphenylsilane is sourced from PubChem (CID 102506110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).