About 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride
2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride (PubChem CID 102506307) has the molecular formula C8H5ClF6O4
and a molecular weight of 314.57 g/mol. Its IUPAC name is 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride.
Molecular Properties
| Compound Name | 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride |
| PubChem CID | 102506307 |
| Molecular Formula | C8H5ClF6O4 |
| Molecular Weight | 314.57 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride |
| SMILES | C[C@@]1(CC(=O)Cl)OC(C(F)(F)F)(C(F)(F)F)OC1=O |
| InChI | InChI=1S/C8H5ClF6O4/c1-5(2-3(9)16)4(17)18-6(19-5,7(10,11)12)8(13,14)15/h2H2,1H3/t5-/m0/s1 |
| InChIKey | OVSQFDIUUWMSRZ-YFKPBYRVSA-N |
| XLogP | 2.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride?
The IUPAC name of 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride (CID 102506307) is 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride.
What is the SMILES notation for 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride?
The canonical SMILES for 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride is C[C@@]1(CC(=O)Cl)OC(C(F)(F)F)(C(F)(F)F)OC1=O.
What is the InChIKey of 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride?
The InChIKey is OVSQFDIUUWMSRZ-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H5ClF6O4/c1-5(2-3(9)16)4(17)18-6(19-5,7(10,11)12)8(13,14)15/h2H2,1H3/t5-/m0/s1.
What are the key properties of 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride?
2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride has a molecular weight of 314.57 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl chloride is sourced from PubChem (CID 102506307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).