C6F4N10O8 — CID 102507099
4-[1-(difluoroamino)-3,5-dinitropyrazol-4-yl]-N,N-difluoro-3,5-dinitropyrazol-1-amine (PubChem CID 102507099) has the molecular formula C6F4N10O8 and a molecular weight of 416.12 g/mol. Its IUPAC name is 4-[1-(difluoroamino)-3,5-dinitropyrazol-4-yl]-N,N-difluoro-3,5-dinitropyrazol-1-amine.
| Compound Name | 4-[1-(difluoroamino)-3,5-dinitropyrazol-4-yl]-N,N-difluoro-3,5-dinitropyrazol-1-amine |
|---|---|
| PubChem CID | 102507099 |
| Molecular Formula | C6F4N10O8 |
| Molecular Weight | 416.12 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | 4-[1-(difluoroamino)-3,5-dinitropyrazol-4-yl]-N,N-difluoro-3,5-dinitropyrazol-1-amine |
| SMILES | O=[N+]([O-])c1nn(N(F)F)c([N+](=O)[O-])c1-c1c([N+](=O)[O-])nn(N(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6F4N10O8/c7-19(8)13-5(17(25)26)1(3(11-13)15(21)22)2-4(16(23)24)12-14(20(9)10)6(2)18(27)28 |
| InChIKey | VZZTXYXOPKYVEM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 214.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.12 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|