C35H40N2O10S — CID 102507235
N-[(2,4-dimethoxyphenyl)methoxy]-3-[methyl-(4-phenoxyphenyl)sulfamoyl]-N-[(2,4,6-trimethoxyphenyl)methyl]propanamide (PubChem CID 102507235) has the molecular formula C35H40N2O10S and a molecular weight of 680.78 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methoxy]-3-[methyl-(4-phenoxyphenyl)sulfamoyl]-N-[(2,4,6-trimethoxyphenyl)methyl]propanamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methoxy]-3-[methyl-(4-phenoxyphenyl)sulfamoyl]-N-[(2,4,6-trimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 102507235 |
| Molecular Formula | C35H40N2O10S |
| Molecular Weight | 680.78 g/mol |
| Exact Mass | 680.24 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methoxy]-3-[methyl-(4-phenoxyphenyl)sulfamoyl]-N-[(2,4,6-trimethoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CON(Cc2c(OC)cc(OC)cc2OC)C(=O)CCS(=O)(=O)N(C)c2ccc(Oc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C35H40N2O10S/c1-36(26-13-16-28(17-14-26)47-27-10-8-7-9-11-27)48(39,40)19-18-35(38)37(46-24-25-12-15-29(41-2)20-32(25)43-4)23-31-33(44-5)21-30(42-3)22-34(31)45-6/h7-17,20-22H,18-19,23-24H2,1-6H3 |
| InChIKey | BGBWBPLKIAPJKL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 122.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.78 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|