C19H21BN2 — CID 102507577
1,3-diethyl-2-[2-(4-methylphenyl)ethynyl]-1,3,2-benzodiazaborole (PubChem CID 102507577) has the molecular formula C19H21BN2 and a molecular weight of 288.20 g/mol. Its IUPAC name is 1,3-diethyl-2-[2-(4-methylphenyl)ethynyl]-1,3,2-benzodiazaborole.
| Compound Name | 1,3-diethyl-2-[2-(4-methylphenyl)ethynyl]-1,3,2-benzodiazaborole |
|---|---|
| PubChem CID | 102507577 |
| Molecular Formula | C19H21BN2 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1,3-diethyl-2-[2-(4-methylphenyl)ethynyl]-1,3,2-benzodiazaborole |
| SMILES | CCN1B(C#Cc2ccc(C)cc2)N(CC)c2ccccc21 |
| InChI | InChI=1S/C19H21BN2/c1-4-21-18-8-6-7-9-19(18)22(5-2)20(21)15-14-17-12-10-16(3)11-13-17/h6-13H,4-5H2,1-3H3 |
| InChIKey | SZBMOVDORQQFAZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|