C21H22N6OS — CID 10250785
6-(4-methylpiperazin-1-yl)-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one (PubChem CID 10250785) has the molecular formula C21H22N6OS and a molecular weight of 406.52 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one.
| Compound Name | 6-(4-methylpiperazin-1-yl)-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 10250785 |
| Molecular Formula | C21H22N6OS |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one |
| SMILES | CN1CCN(c2ccc3c(c2)CN(c2csc(-c4ccncc4)n2)C(=O)N3)CC1 |
| InChI | InChI=1S/C21H22N6OS/c1-25-8-10-26(11-9-25)17-2-3-18-16(12-17)13-27(21(28)23-18)19-14-29-20(24-19)15-4-6-22-7-5-15/h2-7,12,14H,8-11,13H2,1H3,(H,23,28) |
| InChIKey | HYQOGRUXBWHQDQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|