C14H19NO2 — CID 102507909
1-[(4S)-4-benzyl-1,3-oxazolidin-3-yl]butan-1-one (PubChem CID 102507909) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-[(4S)-4-benzyl-1,3-oxazolidin-3-yl]butan-1-one.
| Compound Name | 1-[(4S)-4-benzyl-1,3-oxazolidin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 102507909 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-[(4S)-4-benzyl-1,3-oxazolidin-3-yl]butan-1-one |
| SMILES | CCCC(=O)N1COC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-2-6-14(16)15-11-17-10-13(15)9-12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3/t13-/m0/s1 |
| InChIKey | NCRGDWNSTFUOQD-ZDUSSCGKSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |