C28H25NO2 — CID 10250831
N-[2-(4-Hydroxy-phenyl)-1-phenyl-ethyl]-2,2-diphenyl-acetamide (PubChem CID 10250831) has the molecular formula C28H25NO2 and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)-1-phenylethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-(4-Hydroxy-phenyl)-1-phenyl-ethyl]-2,2-diphenyl-acetamide |
|---|---|
| PubChem CID | 10250831 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)-1-phenylethyl]-2,2-diphenylacetamide |
| SMILES | C1=CC=C(C=C1)C(CC2=CC=C(C=C2)O)NC(=O)C(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | InChI=1S/C28H25NO2/c30-25-18-16-21(17-19-25)20-26(22-10-4-1-5-11-22)29-28(31)27(23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-19,26-27,30H,20H2,(H,29,31) |
| InChIKey | IODVRLYNAUHWGQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | 505 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |