C14H20 — CID 102508391
(1R,7R,10R)-4,10-dimethyl-11-methylidenetricyclo[5.3.1.01,5]undec-4-ene (PubChem CID 102508391) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (1R,7R,10R)-4,10-dimethyl-11-methylidenetricyclo[5.3.1.01,5]undec-4-ene.
| Compound Name | (1R,7R,10R)-4,10-dimethyl-11-methylidenetricyclo[5.3.1.01,5]undec-4-ene |
|---|---|
| PubChem CID | 102508391 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (1R,7R,10R)-4,10-dimethyl-11-methylidenetricyclo[5.3.1.01,5]undec-4-ene |
| SMILES | C=C1[C@@H]2CC[C@@H](C)[C@]13CCC(C)=C3C2 |
| InChI | InChI=1S/C14H20/c1-9-6-7-14-10(2)4-5-12(11(14)3)8-13(9)14/h10,12H,3-8H2,1-2H3/t10-,12-,14-/m1/s1 |
| InChIKey | XCSNBFJLRDSMQK-MPKXVKKWSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|