C15H21N3O3 — CID 102508681
(4E,10E,16E)-1,7,13-triazacyclooctadeca-4,10,16-triene-2,8,14-trione (PubChem CID 102508681) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is (4E,10E,16E)-1,7,13-triazacyclooctadeca-4,10,16-triene-2,8,14-trione.
| Compound Name | (4E,10E,16E)-1,7,13-triazacyclooctadeca-4,10,16-triene-2,8,14-trione |
|---|---|
| PubChem CID | 102508681 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (4E,10E,16E)-1,7,13-triazacyclooctadeca-4,10,16-triene-2,8,14-trione |
| SMILES | O=C1C/C=C/CNC(=O)C/C=C/CNC(=O)C/C=C/CN1 |
| InChI | InChI=1S/C15H21N3O3/c19-13-7-1-4-10-16-14(20)8-3-6-12-18-15(21)9-2-5-11-17-13/h1-6H,7-12H2,(H,16,20)(H,17,19)(H,18,21)/b4-1+,5-2+,6-3+ |
| InChIKey | DCLBKERESIYPHI-GZDDRBCLSA-N |
| XLogP | 0.19 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|