C23H27N3O5 — CID 102508783
dimethyl 5-cyclohexylimino-3-oxo-8-phenyl-2,8-dihydro-1H-pyrazolo[1,2-a]pyridazine-6,7-dicarboxylate (PubChem CID 102508783) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is dimethyl 5-cyclohexylimino-3-oxo-8-phenyl-2,8-dihydro-1H-pyrazolo[1,2-a]pyridazine-6,7-dicarboxylate.
| Compound Name | dimethyl 5-cyclohexylimino-3-oxo-8-phenyl-2,8-dihydro-1H-pyrazolo[1,2-a]pyridazine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 102508783 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | dimethyl 5-cyclohexylimino-3-oxo-8-phenyl-2,8-dihydro-1H-pyrazolo[1,2-a]pyridazine-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(c2ccccc2)N2CCC(=O)N2/C1=N\C1CCCCC1 |
| InChI | InChI=1S/C23H27N3O5/c1-30-22(28)18-19(23(29)31-2)21(24-16-11-7-4-8-12-16)26-17(27)13-14-25(26)20(18)15-9-5-3-6-10-15/h3,5-6,9-10,16,20H,4,7-8,11-14H2,1-2H3/b24-21- |
| InChIKey | CIMXAYVZLFKJIQ-FLFQWRMESA-N |
| XLogP | 2.56 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|