About CID 10250882
CID 10250882 (PubChem CID 10250882) has the molecular formula C23H27F3O3
and a molecular weight of 408.46 g/mol.
Molecular Properties
| Compound Name | CID 10250882 |
| PubChem CID | 10250882 |
| Molecular Formula | C23H27F3O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C23H27F3O3/c24-23(25,26)18-3-1-16(2-4-18)17-5-7-21(8-6-17)27-22(29-28-21)19-10-14-9-15(12-19)13-20(22)11-14/h1-4,14-15,17,19-20H,5-13H2 |
| InChIKey | NIROYXVOJNKFHZ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 10250882 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10250882?
The IUPAC name of CID 10250882 (CID 10250882) is not available.
What is the SMILES notation for CID 10250882?
The canonical SMILES for CID 10250882 is FC(F)(F)c1ccc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1.
What is the InChIKey of CID 10250882?
The InChIKey is NIROYXVOJNKFHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27F3O3/c24-23(25,26)18-3-1-16(2-4-18)17-5-7-21(8-6-17)27-22(29-28-21)19-10-14-9-15(12-19)13-20(22)11-14/h1-4,14-15,17,19-20H,5-13H2.
What are the key properties of CID 10250882?
CID 10250882 has a molecular weight of 408.46 g/mol, XLogP of 6.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10250882 is sourced from PubChem (CID 10250882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).