C12H15NO4S — CID 102508859
(E,2R)-2-amino-4-ethoxycarbonyl-5-thiophen-3-ylpent-4-enoic acid (PubChem CID 102508859) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is (E,2R)-2-amino-4-ethoxycarbonyl-5-thiophen-3-ylpent-4-enoic acid.
| Compound Name | (E,2R)-2-amino-4-ethoxycarbonyl-5-thiophen-3-ylpent-4-enoic acid |
|---|---|
| PubChem CID | 102508859 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (E,2R)-2-amino-4-ethoxycarbonyl-5-thiophen-3-ylpent-4-enoic acid |
| SMILES | CCOC(=O)/C(=C/c1ccsc1)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C12H15NO4S/c1-2-17-12(16)9(6-10(13)11(14)15)5-8-3-4-18-7-8/h3-5,7,10H,2,6,13H2,1H3,(H,14,15)/b9-5+/t10-/m1/s1 |
| InChIKey | NZKOUCXHMWISGM-NAZIUFLLSA-N |
| XLogP | 1.50 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|