About [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone
[5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone (PubChem CID 10250898) has the molecular formula C26H24N4O
and a molecular weight of 408.51 g/mol. Its IUPAC name is [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone |
| PubChem CID | 10250898 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc2c(ccn2C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N4O/c1-4-23-28-24-17(2)14-18(3)27-25(24)30(23)16-19-10-11-22-21(15-19)12-13-29(22)26(31)20-8-6-5-7-9-20/h5-15H,4,16H2,1-3H3 |
| InChIKey | OMUMLNYJHYDQDZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone?
The IUPAC name of [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone (CID 10250898) is [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone.
What is the SMILES notation for [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone?
The canonical SMILES for [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone is CCc1nc2c(C)cc(C)nc2n1Cc1ccc2c(ccn2C(=O)c2ccccc2)c1.
What is the InChIKey of [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone?
The InChIKey is OMUMLNYJHYDQDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N4O/c1-4-23-28-24-17(2)14-18(3)27-25(24)30(23)16-19-10-11-22-21(15-19)12-13-29(22)26(31)20-8-6-5-7-9-20/h5-15H,4,16H2,1-3H3.
What are the key properties of [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone?
[5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone has a molecular weight of 408.51 g/mol, XLogP of 5.30, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]indol-1-yl]-phenylmethanone is sourced from PubChem (CID 10250898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).