C18H26O6 — CID 102509091
dimethyl (3'aS,6'aR)-5,5-dimethyl-3'-methylidenespiro[1,3-dioxane-2,2'-4,5,6,6a-tetrahydro-3aH-pentalene]-1',1'-dicarboxylate (PubChem CID 102509091) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is dimethyl (3'aS,6'aR)-5,5-dimethyl-3'-methylidenespiro[1,3-dioxane-2,2'-4,5,6,6a-tetrahydro-3aH-pentalene]-1',1'-dicarboxylate.
| Compound Name | dimethyl (3'aS,6'aR)-5,5-dimethyl-3'-methylidenespiro[1,3-dioxane-2,2'-4,5,6,6a-tetrahydro-3aH-pentalene]-1',1'-dicarboxylate |
|---|---|
| PubChem CID | 102509091 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | dimethyl (3'aS,6'aR)-5,5-dimethyl-3'-methylidenespiro[1,3-dioxane-2,2'-4,5,6,6a-tetrahydro-3aH-pentalene]-1',1'-dicarboxylate |
| SMILES | C=C1[C@H]2CCC[C@H]2C(C(=O)OC)(C(=O)OC)C12OCC(C)(C)CO2 |
| InChI | InChI=1S/C18H26O6/c1-11-12-7-6-8-13(12)17(14(19)21-4,15(20)22-5)18(11)23-9-16(2,3)10-24-18/h12-13H,1,6-10H2,2-5H3/t12-,13-/m1/s1 |
| InChIKey | SGWRCWRHOUQBGA-CHWSQXEVSA-N |
| XLogP | 2.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|