C15H13ClFN5O6S — CID 102509152
methyl 3-chloro-2-[(5-ethoxy-7-fluoro-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonylamino]-5-hydroxybenzoate (PubChem CID 102509152) has the molecular formula C15H13ClFN5O6S and a molecular weight of 445.82 g/mol. Its IUPAC name is methyl 3-chloro-2-[(5-ethoxy-7-fluoro-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonylamino]-5-hydroxybenzoate.
| Compound Name | methyl 3-chloro-2-[(5-ethoxy-7-fluoro-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonylamino]-5-hydroxybenzoate |
|---|---|
| PubChem CID | 102509152 |
| Molecular Formula | C15H13ClFN5O6S |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | methyl 3-chloro-2-[(5-ethoxy-7-fluoro-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl)sulfonylamino]-5-hydroxybenzoate |
| SMILES | CCOc1nc(F)cc2nc(S(=O)(=O)Nc3c(Cl)cc(O)cc3C(=O)OC)nn12 |
| InChI | InChI=1S/C15H13ClFN5O6S/c1-3-28-15-18-10(17)6-11-19-14(20-22(11)15)29(25,26)21-12-8(13(24)27-2)4-7(23)5-9(12)16/h4-6,21,23H,3H2,1-2H3 |
| InChIKey | RRMYVSZQIFXWGF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 145.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|