C12H17N3O5 — CID 102509538
(3aR,4R,7S,7aS)-4-(azidomethyl)-7-hydroxyspiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-one (PubChem CID 102509538) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-4-(azidomethyl)-7-hydroxyspiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-one.
| Compound Name | (3aR,4R,7S,7aS)-4-(azidomethyl)-7-hydroxyspiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-one |
|---|---|
| PubChem CID | 102509538 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (3aR,4R,7S,7aS)-4-(azidomethyl)-7-hydroxyspiro[3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-6-one |
| SMILES | [N-]=[N+]=NC[C@H]1OC(=O)[C@@H](O)[C@@H]2OC3(CCCCC3)O[C@@H]21 |
| InChI | InChI=1S/C12H17N3O5/c13-15-14-6-7-9-10(8(16)11(17)18-7)20-12(19-9)4-2-1-3-5-12/h7-10,16H,1-6H2/t7-,8+,9-,10+/m1/s1 |
| InChIKey | RJYASWMHTSTCBQ-RGOKHQFPSA-N |
| XLogP | 1.03 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|