About 2-phenyl-2,3-dihydrochromen-4-one
2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 10251) has the molecular formula C15H12O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-phenyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 2-phenyl-2,3-dihydrochromen-4-one |
| PubChem CID | 10251 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C15H12O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-9,15H,10H2 |
| InChIKey | ZONYXWQDUYMKFB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2,3-dihydrochromen-4-one?
The IUPAC name of 2-phenyl-2,3-dihydrochromen-4-one (CID 10251) is 2-phenyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 2-phenyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 2-phenyl-2,3-dihydrochromen-4-one is O=C1CC(c2ccccc2)Oc2ccccc21.
What is the InChIKey of 2-phenyl-2,3-dihydrochromen-4-one?
The InChIKey is ZONYXWQDUYMKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-9,15H,10H2.
What are the key properties of 2-phenyl-2,3-dihydrochromen-4-one?
2-phenyl-2,3-dihydrochromen-4-one has a molecular weight of 224.26 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 10251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).