C43H50F6O2S2 — CID 102510234
3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-octoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-2-methyl-5-(4-octoxyphenyl)thiophene (PubChem CID 102510234) has the molecular formula C43H50F6O2S2 and a molecular weight of 776.99 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-octoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-2-methyl-5-(4-octoxyphenyl)thiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-octoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-2-methyl-5-(4-octoxyphenyl)thiophene |
|---|---|
| PubChem CID | 102510234 |
| Molecular Formula | C43H50F6O2S2 |
| Molecular Weight | 776.99 g/mol |
| Exact Mass | 776.32 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(4-octoxyphenyl)thiophen-3-yl]cyclopenten-1-yl]-2-methyl-5-(4-octoxyphenyl)thiophene |
| SMILES | CCCCCCCCOc1ccc(-c2cc(C3=C(c4cc(-c5ccc(OCCCCCCCC)cc5)sc4C)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/C43H50F6O2S2/c1-5-7-9-11-13-15-25-50-33-21-17-31(18-22-33)37-27-35(29(3)52-37)39-40(42(46,47)43(48,49)41(39,44)45)36-28-38(53-30(36)4)32-19-23-34(24-20-32)51-26-16-14-12-10-8-6-2/h17-24,27-28H,5-16,25-26H2,1-4H3 |
| InChIKey | FUIYDYANCKOQLE-UHFFFAOYSA-N |
| XLogP | 15.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.99 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|