C27H15N3 — CID 102510553
2,4,6-tris(4-ethynylphenyl)-1,3,5-triazine (PubChem CID 102510553) has the molecular formula C27H15N3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 2,4,6-tris(4-ethynylphenyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(4-ethynylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 102510553 |
| Molecular Formula | C27H15N3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2,4,6-tris(4-ethynylphenyl)-1,3,5-triazine |
| SMILES | C#Cc1ccc(-c2nc(-c3ccc(C#C)cc3)nc(-c3ccc(C#C)cc3)n2)cc1 |
| InChI | InChI=1S/C27H15N3/c1-4-19-7-13-22(14-8-19)25-28-26(23-15-9-20(5-2)10-16-23)30-27(29-25)24-17-11-21(6-3)12-18-24/h1-3,7-18H |
| InChIKey | SSAOTGYMADTRMZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|