C26H23N3O3 — CID 102510756
(2R,16S,17R)-N-benzyl-15-oxo-21-oxa-4,14-diazahexacyclo[16.2.1.01,16.02,14.03,11.05,10]henicosa-3(11),5,7,9,19-pentaene-17-carboxamide (PubChem CID 102510756) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is (2R,16S,17R)-N-benzyl-15-oxo-21-oxa-4,14-diazahexacyclo[16.2.1.01,16.02,14.03,11.05,10]henicosa-3(11),5,7,9,19-pentaene-17-carboxamide.
| Compound Name | (2R,16S,17R)-N-benzyl-15-oxo-21-oxa-4,14-diazahexacyclo[16.2.1.01,16.02,14.03,11.05,10]henicosa-3(11),5,7,9,19-pentaene-17-carboxamide |
|---|---|
| PubChem CID | 102510756 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (2R,16S,17R)-N-benzyl-15-oxo-21-oxa-4,14-diazahexacyclo[16.2.1.01,16.02,14.03,11.05,10]henicosa-3(11),5,7,9,19-pentaene-17-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@H]1C2C=CC3(O2)[C@H]1C(=O)N1CCc2c([nH]c4ccccc24)[C@@H]13 |
| InChI | InChI=1S/C26H23N3O3/c30-24(27-14-15-6-2-1-3-7-15)20-19-10-12-26(32-19)21(20)25(31)29-13-11-17-16-8-4-5-9-18(16)28-22(17)23(26)29/h1-10,12,19-21,23,28H,11,13-14H2,(H,27,30)/t19?,20-,21+,23+,26?/m0/s1 |
| InChIKey | PRZUMMSOHRVLQV-DVYGNFTASA-N |
| XLogP | 2.86 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|