C24H33N3O3 — CID 10251078
(2S)-2-amino-3-(4-methoxy-2,6-dimethylphenyl)-N-[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]propanamide (PubChem CID 10251078) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-methoxy-2,6-dimethylphenyl)-N-[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]propanamide.
| Compound Name | (2S)-2-amino-3-(4-methoxy-2,6-dimethylphenyl)-N-[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 10251078 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | (2S)-2-amino-3-(4-methoxy-2,6-dimethylphenyl)-N-[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]propanamide |
| SMILES | COc1cc(C)c(C[C@H](N)C(=O)N[C@H](C)C(=O)NCCCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H33N3O3/c1-16-13-20(30-4)14-17(2)21(16)15-22(25)24(29)27-18(3)23(28)26-12-8-11-19-9-6-5-7-10-19/h5-7,9-10,13-14,18,22H,8,11-12,15,25H2,1-4H3,(H,26,28)(H,27,29)/t18-,22+/m1/s1 |
| InChIKey | BDESELADPKLTQU-GCJKJVERSA-N |
| XLogP | 2.44 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|