C24H20N2O2 — CID 102510836
23-(2-hydroxypropyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-14-one (PubChem CID 102510836) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 23-(2-hydroxypropyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-14-one.
| Compound Name | 23-(2-hydroxypropyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-14-one |
|---|---|
| PubChem CID | 102510836 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 23-(2-hydroxypropyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-14-one |
| SMILES | CC(O)CC1c2ccccc2-c2c3c(c4c([nH]c5ccccc54)c21)CNC3=O |
| InChI | InChI=1S/C24H20N2O2/c1-12(27)10-16-13-6-2-3-7-14(13)20-21(16)23-19(17-11-25-24(28)22(17)20)15-8-4-5-9-18(15)26-23/h2-9,12,16,26-27H,10-11H2,1H3,(H,25,28) |
| InChIKey | PTFLISJAAPDVER-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |