C25H52O2Si — CID 10251138
(Z)-9-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-7-en-6-ol (PubChem CID 10251138) has the molecular formula C25H52O2Si and a molecular weight of 412.78 g/mol. Its IUPAC name is (Z)-9-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-7-en-6-ol.
| Compound Name | (Z)-9-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-7-en-6-ol |
|---|---|
| PubChem CID | 10251138 |
| Molecular Formula | C25H52O2Si |
| Molecular Weight | 412.78 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | (Z)-9-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-7-en-6-ol |
| SMILES | CCCCCCCCCC(/C=C\C(O)CCCC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O2Si/c1-9-10-11-12-13-14-15-19-24(27-28(7,8)25(4,5)6)21-20-23(26)18-16-17-22(2)3/h20-24,26H,9-19H2,1-8H3/b21-20- |
| InChIKey | QEHFTUXBZWZQIF-MRCUWXFGSA-N |
| XLogP | 8.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.78 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|