C28H54O5Si3 — CID 102511546
(2R,3R,4aS,5R,8aS)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2,3,4a,5,8,8a-hexahydronaphthalene-1,4-dione (PubChem CID 102511546) has the molecular formula C28H54O5Si3 and a molecular weight of 554.99 g/mol. Its IUPAC name is (2R,3R,4aS,5R,8aS)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2,3,4a,5,8,8a-hexahydronaphthalene-1,4-dione.
| Compound Name | (2R,3R,4aS,5R,8aS)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2,3,4a,5,8,8a-hexahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 102511546 |
| Molecular Formula | C28H54O5Si3 |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | (2R,3R,4aS,5R,8aS)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2,3,4a,5,8,8a-hexahydronaphthalene-1,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=CC[C@@H]2C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C28H54O5Si3/c1-26(2,3)34(10,11)31-20-18-16-17-19-21(20)23(30)25(33-36(14,15)28(7,8)9)24(22(19)29)32-35(12,13)27(4,5)6/h16,18-21,24-25H,17H2,1-15H3/t19-,20+,21-,24-,25-/m0/s1 |
| InChIKey | VXOKABKERSQVNM-KOSDUOMESA-N |
| XLogP | 7.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|