C12H17NO — CID 102511702
(4S,8R,13S)-1-azatricyclo[6.3.2.04,13]tridec-6-en-12-one (PubChem CID 102511702) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (4S,8R,13S)-1-azatricyclo[6.3.2.04,13]tridec-6-en-12-one.
| Compound Name | (4S,8R,13S)-1-azatricyclo[6.3.2.04,13]tridec-6-en-12-one |
|---|---|
| PubChem CID | 102511702 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (4S,8R,13S)-1-azatricyclo[6.3.2.04,13]tridec-6-en-12-one |
| SMILES | O=C1[C@H]2[C@H]3CC=C[C@H]2CCCN1CC3 |
| InChI | InChI=1S/C12H17NO/c14-12-11-9-3-1-4-10(11)6-8-13(12)7-2-5-9/h1,3,9-11H,2,4-8H2/t9-,10-,11+/m0/s1 |
| InChIKey | AIUVTCKVHINPGB-GARJFASQSA-N |
| XLogP | 1.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|