About 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one
2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one (PubChem CID 102511725) has the molecular formula C14H25NOSi
and a molecular weight of 251.45 g/mol. Its IUPAC name is 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one.
Molecular Properties
| Compound Name | 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one |
| PubChem CID | 102511725 |
| Molecular Formula | C14H25NOSi |
| Molecular Weight | 251.45 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one |
| SMILES | CC(C)C1CC(=O)C=CN1C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C14H25NOSi/c1-12(2)14-11-13(16)7-9-15(14)8-6-10-17(3,4)5/h6-7,9-10,12,14H,8,11H2,1-5H3/b10-6+ |
| InChIKey | OETORARQPXEIFO-UXBLZVDNSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one?
The IUPAC name of 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one (CID 102511725) is 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one.
What is the SMILES notation for 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one?
The canonical SMILES for 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one is CC(C)C1CC(=O)C=CN1C/C=C/[Si](C)(C)C.
What is the InChIKey of 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one?
The InChIKey is OETORARQPXEIFO-UXBLZVDNSA-N. The full InChI is InChI=1S/C14H25NOSi/c1-12(2)14-11-13(16)7-9-15(14)8-6-10-17(3,4)5/h6-7,9-10,12,14H,8,11H2,1-5H3/b10-6+.
What are the key properties of 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one?
2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one has a molecular weight of 251.45 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1-[(E)-3-trimethylsilylprop-2-enyl]-2,3-dihydropyridin-4-one is sourced from PubChem (CID 102511725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).