About 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one
4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one (PubChem CID 102511849) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one |
| PubChem CID | 102511849 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one |
| SMILES | CC1(C)OC(C2COC(=O)O2)CCC1O |
| InChI | InChI=1S/C10H16O5/c1-10(2)8(11)4-3-6(15-10)7-5-13-9(12)14-7/h6-8,11H,3-5H2,1-2H3 |
| InChIKey | WADSSLQSJHENAD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one?
The IUPAC name of 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one (CID 102511849) is 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one.
What is the SMILES notation for 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one?
The canonical SMILES for 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one is CC1(C)OC(C2COC(=O)O2)CCC1O.
What is the InChIKey of 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one?
The InChIKey is WADSSLQSJHENAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5/c1-10(2)8(11)4-3-6(15-10)7-5-13-9(12)14-7/h6-8,11H,3-5H2,1-2H3.
What are the key properties of 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one?
4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one has a molecular weight of 216.23 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-hydroxy-6,6-dimethyloxan-2-yl)-1,3-dioxolan-2-one is sourced from PubChem (CID 102511849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).