C23H23NO4S — CID 102511998
3-[(1R,2S,3R)-1-hydroxy-3-phenyl-2,3,7,8,9,10-hexahydro-1H-benzo[f]thiochromene-2-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 102511998) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-[(1R,2S,3R)-1-hydroxy-3-phenyl-2,3,7,8,9,10-hexahydro-1H-benzo[f]thiochromene-2-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1R,2S,3R)-1-hydroxy-3-phenyl-2,3,7,8,9,10-hexahydro-1H-benzo[f]thiochromene-2-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102511998 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 3-[(1R,2S,3R)-1-hydroxy-3-phenyl-2,3,7,8,9,10-hexahydro-1H-benzo[f]thiochromene-2-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C(=O)[C@@H]1[C@@H](O)c2c(ccc3c2CCCC3)S[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H23NO4S/c25-20-18-16-9-5-4-6-14(16)10-11-17(18)29-21(15-7-2-1-3-8-15)19(20)22(26)24-12-13-28-23(24)27/h1-3,7-8,10-11,19-21,25H,4-6,9,12-13H2/t19-,20+,21+/m1/s1 |
| InChIKey | SDOHWGWGRKRLPY-HKBOAZHASA-N |
| XLogP | 4.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |