C12H15NO3 — CID 102512025
methyl (1R,2R,6R)-1-cyano-3-formyl-2,6-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 102512025) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is methyl (1R,2R,6R)-1-cyano-3-formyl-2,6-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2R,6R)-1-cyano-3-formyl-2,6-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102512025 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | methyl (1R,2R,6R)-1-cyano-3-formyl-2,6-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C#N)[C@H](C)CC=C(C=O)[C@H]1C |
| InChI | InChI=1S/C12H15NO3/c1-8-4-5-10(6-14)9(2)12(8,7-13)11(15)16-3/h5-6,8-9H,4H2,1-3H3/t8-,9-,12-/m1/s1 |
| InChIKey | DNJYRIBJTHCYGJ-KBVBSXBZSA-N |
| XLogP | 1.47 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|