About (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde
(8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde (PubChem CID 102513298) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde.
Molecular Properties
| Compound Name | (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde |
| PubChem CID | 102513298 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde |
| SMILES | CCCC[C@@]1(C=O)CCC=C2C=CC(=O)O[C@H]21 |
| InChI | InChI=1S/C14H18O3/c1-2-3-8-14(10-15)9-4-5-11-6-7-12(16)17-13(11)14/h5-7,10,13H,2-4,8-9H2,1H3/t13-,14+/m1/s1 |
| InChIKey | TXNFWYKRKYFQII-KGLIPLIRSA-N |
| XLogP | 2.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde?
The IUPAC name of (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde (CID 102513298) is (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde.
What is the SMILES notation for (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde?
The canonical SMILES for (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde is CCCC[C@@]1(C=O)CCC=C2C=CC(=O)O[C@H]21.
What is the InChIKey of (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde?
The InChIKey is TXNFWYKRKYFQII-KGLIPLIRSA-N. The full InChI is InChI=1S/C14H18O3/c1-2-3-8-14(10-15)9-4-5-11-6-7-12(16)17-13(11)14/h5-7,10,13H,2-4,8-9H2,1H3/t13-,14+/m1/s1.
What are the key properties of (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde?
(8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde has a molecular weight of 234.29 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8R,8aR)-8-butyl-2-oxo-7,8a-dihydro-6H-chromene-8-carbaldehyde is sourced from PubChem (CID 102513298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).