C25H36O5 — CID 10251353
(1S,3R,3'S,5'R,6S,7R,9E,15R,16S)-13,15-dihydroxy-3,3',15-trimethyl-5'-(2-methylprop-1-enyl)spiro[12-oxatetracyclo[8.5.1.03,7.013,16]hexadec-9-ene-6,2'-oxolane]-11-one (PubChem CID 10251353) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is (1S,3R,3'S,5'R,6S,7R,9E,15R,16S)-13,15-dihydroxy-3,3',15-trimethyl-5'-(2-methylprop-1-enyl)spiro[12-oxatetracyclo[8.5.1.03,7.013,16]hexadec-9-ene-6,2'-oxolane]-11-one.
| Compound Name | (1S,3R,3'S,5'R,6S,7R,9E,15R,16S)-13,15-dihydroxy-3,3',15-trimethyl-5'-(2-methylprop-1-enyl)spiro[12-oxatetracyclo[8.5.1.03,7.013,16]hexadec-9-ene-6,2'-oxolane]-11-one |
|---|---|
| PubChem CID | 10251353 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (1S,3R,3'S,5'R,6S,7R,9E,15R,16S)-13,15-dihydroxy-3,3',15-trimethyl-5'-(2-methylprop-1-enyl)spiro[12-oxatetracyclo[8.5.1.03,7.013,16]hexadec-9-ene-6,2'-oxolane]-11-one |
| SMILES | CC(C)=C[C@H]1C[C@H](C)[C@]2(CC[C@]3(C)C[C@H]4[C@H]5/C(=C\C[C@H]32)C(=O)OC5(O)C[C@@]4(C)O)O1 |
| InChI | InChI=1S/C25H36O5/c1-14(2)10-16-11-15(3)24(29-16)9-8-22(4)12-18-20-17(6-7-19(22)24)21(26)30-25(20,28)13-23(18,5)27/h6,10,15-16,18-20,27-28H,7-9,11-13H2,1-5H3/b17-6+/t15-,16-,18-,19+,20+,22+,23+,24-,25?/m0/s1 |
| InChIKey | ABMVTHXMVSOQJZ-IOELNNTDSA-N |
| XLogP | 3.89 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|