About 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol
1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol (PubChem CID 102513538) has the molecular formula C12H20OS2
and a molecular weight of 244.42 g/mol. Its IUPAC name is 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol |
| PubChem CID | 102513538 |
| Molecular Formula | C12H20OS2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol |
| SMILES | C=CC1(CC2(O)CCCC2)SCCCS1 |
| InChI | InChI=1S/C12H20OS2/c1-2-12(14-8-5-9-15-12)10-11(13)6-3-4-7-11/h2,13H,1,3-10H2 |
| InChIKey | DKBKFDVOZRBJCQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol?
The IUPAC name of 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol (CID 102513538) is 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol.
What is the SMILES notation for 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol?
The canonical SMILES for 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol is C=CC1(CC2(O)CCCC2)SCCCS1.
What is the InChIKey of 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol?
The InChIKey is DKBKFDVOZRBJCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20OS2/c1-2-12(14-8-5-9-15-12)10-11(13)6-3-4-7-11/h2,13H,1,3-10H2.
What are the key properties of 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol?
1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol has a molecular weight of 244.42 g/mol, XLogP of 3.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-ethenyl-1,3-dithian-2-yl)methyl]cyclopentan-1-ol is sourced from PubChem (CID 102513538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).