About (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one
(2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one (PubChem CID 102515001) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one.
Analyze (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one?
The IUPAC name of (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one (CID 102515001) is (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one.
What is the SMILES notation for (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one?
The canonical SMILES for (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one is C[C@H]1OC=C(O)C(=O)[C@H]1O.
What is the InChIKey of (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one?
The InChIKey is WVBINZLSBQRJFB-WUJLRWPWSA-N. The full InChI is InChI=1S/C6H8O4/c1-3-5(8)6(9)4(7)2-10-3/h2-3,5,7-8H,1H3/t3-,5+/m1/s1.
What are the key properties of (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one?
(2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one has a molecular weight of 144.13 g/mol, XLogP of -0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-3,5-dihydroxy-2-methyl-2,3-dihydropyran-4-one is sourced from PubChem (CID 102515001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).