C25H40 — CID 102515469
(1R,3E,7E,11R,12R,15S,16R)-1,4,8,12-tetramethyl-15-prop-1-en-2-yltricyclo[9.7.0.012,16]octadeca-3,7-diene (PubChem CID 102515469) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (1R,3E,7E,11R,12R,15S,16R)-1,4,8,12-tetramethyl-15-prop-1-en-2-yltricyclo[9.7.0.012,16]octadeca-3,7-diene.
| Compound Name | (1R,3E,7E,11R,12R,15S,16R)-1,4,8,12-tetramethyl-15-prop-1-en-2-yltricyclo[9.7.0.012,16]octadeca-3,7-diene |
|---|---|
| PubChem CID | 102515469 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (1R,3E,7E,11R,12R,15S,16R)-1,4,8,12-tetramethyl-15-prop-1-en-2-yltricyclo[9.7.0.012,16]octadeca-3,7-diene |
| SMILES | C=C(C)[C@H]1CC[C@]2(C)[C@@H]1CC[C@]1(C)C/C=C(\C)CC/C=C(\C)CC[C@H]12 |
| InChI | InChI=1S/C25H40/c1-18(2)21-13-17-25(6)22(21)14-16-24(5)15-12-20(4)9-7-8-19(3)10-11-23(24)25/h8,12,21-23H,1,7,9-11,13-17H2,2-6H3/b19-8+,20-12+/t21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | JFQLHYSXZPELNV-LNYIGJDBSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|