About 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate
6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate (PubChem CID 102515496) has the molecular formula C9H5O5-
and a molecular weight of 193.13 g/mol. Its IUPAC name is 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate.
Molecular Properties
| Compound Name | 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate |
| PubChem CID | 102515496 |
| Molecular Formula | C9H5O5- |
| Molecular Weight | 193.13 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate |
| SMILES | O=C1OCc2cc(=O)c(O)cc([O-])c21 |
| InChI | InChI=1S/C9H6O5/c10-5-1-4-3-14-9(13)8(4)7(12)2-6(5)11/h1-2,12H,3H2,(H,10,11)/p-1 |
| InChIKey | FZWZZYUAWYMFBS-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.13 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate?
The IUPAC name of 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate (CID 102515496) is 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate.
What is the SMILES notation for 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate?
The canonical SMILES for 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate is O=C1OCc2cc(=O)c(O)cc([O-])c21.
What is the InChIKey of 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate?
The InChIKey is FZWZZYUAWYMFBS-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H6O5/c10-5-1-4-3-14-9(13)8(4)7(12)2-6(5)11/h1-2,12H,3H2,(H,10,11)/p-1.
What are the key properties of 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate?
6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate has a molecular weight of 193.13 g/mol, XLogP of -0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1,5-dioxo-3H-cyclohepta[c]furan-8-olate is sourced from PubChem (CID 102515496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).