C12H13BrO2 — CID 102515567
(3S,4R,5S)-4-bromo-3,5-dimethyl-5-phenyloxolan-2-one (PubChem CID 102515567) has the molecular formula C12H13BrO2 and a molecular weight of 269.14 g/mol. Its IUPAC name is (3S,4R,5S)-4-bromo-3,5-dimethyl-5-phenyloxolan-2-one.
| Compound Name | (3S,4R,5S)-4-bromo-3,5-dimethyl-5-phenyloxolan-2-one |
|---|---|
| PubChem CID | 102515567 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | (3S,4R,5S)-4-bromo-3,5-dimethyl-5-phenyloxolan-2-one |
| SMILES | C[C@H]1C(=O)O[C@@](C)(c2ccccc2)[C@@H]1Br |
| InChI | InChI=1S/C12H13BrO2/c1-8-10(13)12(2,15-11(8)14)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-,10-,12+/m1/s1 |
| InChIKey | FMOJMAVHHMSPEK-UISBYWKRSA-N |
| XLogP | 2.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|