C19H24O — CID 102515634
(1S,4R,8R)-2-(3,5-dimethylphenyl)-8-methoxy-1,8-dimethylbicyclo[2.2.2]octa-2,5-diene (PubChem CID 102515634) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is (1S,4R,8R)-2-(3,5-dimethylphenyl)-8-methoxy-1,8-dimethylbicyclo[2.2.2]octa-2,5-diene.
| Compound Name | (1S,4R,8R)-2-(3,5-dimethylphenyl)-8-methoxy-1,8-dimethylbicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 102515634 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (1S,4R,8R)-2-(3,5-dimethylphenyl)-8-methoxy-1,8-dimethylbicyclo[2.2.2]octa-2,5-diene |
| SMILES | CO[C@]1(C)C[C@@]2(C)C=C[C@@H]1C=C2c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H24O/c1-13-8-14(2)10-15(9-13)17-11-16-6-7-18(17,3)12-19(16,4)20-5/h6-11,16H,12H2,1-5H3/t16-,18-,19-/m1/s1 |
| InChIKey | VNXDQLCVMZZSRT-BHIYHBOVSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|