About [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane
[(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane (PubChem CID 102515912) has the molecular formula C21H42OSi
and a molecular weight of 338.65 g/mol. Its IUPAC name is [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane.
Molecular Properties
| Compound Name | [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane |
| PubChem CID | 102515912 |
| Molecular Formula | C21H42OSi |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane |
| SMILES | CCCCCC/C=C/[C@@H](O[Si](CC)(CC)CC)C1CCCCC1 |
| InChI | InChI=1S/C21H42OSi/c1-5-9-10-11-12-16-19-21(20-17-14-13-15-18-20)22-23(6-2,7-3)8-4/h16,19-21H,5-15,17-18H2,1-4H3/b19-16+/t21-/m1/s1 |
| InChIKey | MSURTRSWHBTUEP-WEIUTZTHSA-N |
| XLogP | 7.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane?
The IUPAC name of [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane (CID 102515912) is [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane.
What is the SMILES notation for [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane?
The canonical SMILES for [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane is CCCCCC/C=C/[C@@H](O[Si](CC)(CC)CC)C1CCCCC1.
What is the InChIKey of [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane?
The InChIKey is MSURTRSWHBTUEP-WEIUTZTHSA-N. The full InChI is InChI=1S/C21H42OSi/c1-5-9-10-11-12-16-19-21(20-17-14-13-15-18-20)22-23(6-2,7-3)8-4/h16,19-21H,5-15,17-18H2,1-4H3/b19-16+/t21-/m1/s1.
What are the key properties of [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane?
[(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane has a molecular weight of 338.65 g/mol, XLogP of 7.48, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,1S)-1-cyclohexylnon-2-enoxy]-triethylsilane is sourced from PubChem (CID 102515912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).