C24H26O3 — CID 102515944
(1S,4R,5S)-4-methyl-5-(2-phenylethyl)-4-(3-phenylpropanoyl)-6-oxabicyclo[3.2.0]heptan-7-one (PubChem CID 102515944) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1S,4R,5S)-4-methyl-5-(2-phenylethyl)-4-(3-phenylpropanoyl)-6-oxabicyclo[3.2.0]heptan-7-one.
| Compound Name | (1S,4R,5S)-4-methyl-5-(2-phenylethyl)-4-(3-phenylpropanoyl)-6-oxabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 102515944 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (1S,4R,5S)-4-methyl-5-(2-phenylethyl)-4-(3-phenylpropanoyl)-6-oxabicyclo[3.2.0]heptan-7-one |
| SMILES | C[C@@]1(C(=O)CCc2ccccc2)CC[C@@H]2C(=O)O[C@@]21CCc1ccccc1 |
| InChI | InChI=1S/C24H26O3/c1-23(21(25)13-12-18-8-4-2-5-9-18)16-15-20-22(26)27-24(20,23)17-14-19-10-6-3-7-11-19/h2-11,20H,12-17H2,1H3/t20-,23+,24+/m1/s1 |
| InChIKey | XRCADDQRPTWNPS-QDSKXPNFSA-N |
| XLogP | 4.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|