C17H19ClN6O3S — CID 10251693
N'-(5-chloro-2-pyridinyl)-N-[2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]ethyl]oxamide (PubChem CID 10251693) has the molecular formula C17H19ClN6O3S and a molecular weight of 422.90 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-[2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]ethyl]oxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-[2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]ethyl]oxamide |
|---|---|
| PubChem CID | 10251693 |
| Molecular Formula | C17H19ClN6O3S |
| Molecular Weight | 422.90 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-[2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]ethyl]oxamide |
| SMILES | CN1CCc2nc(C(=O)NCCNC(=O)C(=O)Nc3ccc(Cl)cn3)sc2C1 |
| InChI | InChI=1S/C17H19ClN6O3S/c1-24-7-4-11-12(9-24)28-17(22-11)16(27)20-6-5-19-14(25)15(26)23-13-3-2-10(18)8-21-13/h2-3,8H,4-7,9H2,1H3,(H,19,25)(H,20,27)(H,21,23,26) |
| InChIKey | BTNQPAJJNGFTSH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.90 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|