About 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione
4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione (PubChem CID 102517164) has the molecular formula C14H18O2S2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione.
Molecular Properties
| Compound Name | 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione |
| PubChem CID | 102517164 |
| Molecular Formula | C14H18O2S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione |
| SMILES | CC(C)(C)C1=c2sc(=O)sc2=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C14H18O2S2/c1-13(2,3)7-9(15)8(14(4,5)6)11-10(7)17-12(16)18-11/h1-6H3 |
| InChIKey | QFVRZHMXFRULLW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione?
The IUPAC name of 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione (CID 102517164) is 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione.
What is the SMILES notation for 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione?
The canonical SMILES for 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione is CC(C)(C)C1=c2sc(=O)sc2=C(C(C)(C)C)C1=O.
What is the InChIKey of 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione?
The InChIKey is QFVRZHMXFRULLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2S2/c1-13(2,3)7-9(15)8(14(4,5)6)11-10(7)17-12(16)18-11/h1-6H3.
What are the key properties of 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione?
4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione has a molecular weight of 282.43 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-ditert-butylcyclopenta[d][1,3]dithiole-2,5-dione is sourced from PubChem (CID 102517164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).