About 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole
2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole (PubChem CID 102517221) has the molecular formula C18H16N2OS
and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole |
| PubChem CID | 102517221 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole |
| SMILES | c1ccc(-c2nc(SCC3CO3)[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2OS/c1-3-7-13(8-4-1)16-17(14-9-5-2-6-10-14)20-18(19-16)22-12-15-11-21-15/h1-10,15H,11-12H2,(H,19,20) |
| InChIKey | OWFMHPWFNAJMCY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole (CID 102517221) is 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole is c1ccc(-c2nc(SCC3CO3)[nH]c2-c2ccccc2)cc1.
What is the InChIKey of 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole?
The InChIKey is OWFMHPWFNAJMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2OS/c1-3-7-13(8-4-1)16-17(14-9-5-2-6-10-14)20-18(19-16)22-12-15-11-21-15/h1-10,15H,11-12H2,(H,19,20).
What are the key properties of 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole?
2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole has a molecular weight of 308.41 g/mol, XLogP of 4.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethylsulfanyl)-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 102517221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).